[libcamera-devel] [PATCH v4 4/4] ipa: ipu3: Add support for IPU3 AEC/AGC algorithm

Jean-Michel Hautbois jeanmichel.hautbois at ideasonboard.com
Tue Mar 30 23:12:10 CEST 2021


Inherit from the Algorithm class to implement basic auto-exposure and
auto-gain functions.
Extract computeTargetExposure() and computeGain() and adapt those to the
IPU3 structure.
Filtering was added too as it avoids big steps when exposure changes a
lot.

Signed-off-by: Jean-Michel Hautbois <jeanmichel.hautbois at ideasonboard.com>
---
 src/ipa/ipu3/ipu3.cpp     |  12 +-
 src/ipa/ipu3/ipu3_agc.cpp | 228 ++++++++++++++++++++++++++++++++++++++
 src/ipa/ipu3/ipu3_agc.h   |  67 +++++++++++
 src/ipa/ipu3/meson.build  |   1 +
 4 files changed, 307 insertions(+), 1 deletion(-)
 create mode 100644 src/ipa/ipu3/ipu3_agc.cpp
 create mode 100644 src/ipa/ipu3/ipu3_agc.h

diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp
index 1cce11c9..848437b5 100644
--- a/src/ipa/ipu3/ipu3.cpp
+++ b/src/ipa/ipu3/ipu3.cpp
@@ -21,6 +21,7 @@
 #include "libcamera/internal/buffer.h"
 #include "libcamera/internal/log.h"
 
+#include "ipu3_agc.h"
 #include "ipu3_awb.h"
 
 static constexpr uint32_t kMaxCellWidthPerSet = 160;
@@ -70,6 +71,8 @@ private:
 
 	/* Interface to the AWB algorithm */
 	std::unique_ptr<ipa::IPU3Awb> awbAlgo_;
+	/* Interface to the AEC/AGC algorithm */
+	std::unique_ptr<ipa::IPU3Agc> agcAlgo_;
 
 	/* Local parameter storage */
 	struct ipu3_uapi_params params_;
@@ -169,6 +172,9 @@ void IPAIPU3::configure(const std::map<uint32_t, ControlInfoMap> &entityControls
 
 	awbAlgo_ = std::make_unique<ipa::IPU3Awb>();
 	awbAlgo_->initialise(params_, bdsOutputSize, bdsGrid_);
+
+	agcAlgo_ = std::make_unique<ipa::IPU3Agc>();
+	agcAlgo_->initialise(bdsGrid_);
 }
 
 void IPAIPU3::mapBuffers(const std::vector<IPABuffer> &buffers)
@@ -240,7 +246,8 @@ void IPAIPU3::processControls([[maybe_unused]] unsigned int frame,
 
 void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params)
 {
-	awbAlgo_->updateWbParameters(params_, 1.0);
+	if (agcAlgo_->updateControls())
+		awbAlgo_->updateWbParameters(params_, agcAlgo_->gamma());
 
 	*params = params_;
 
@@ -255,7 +262,10 @@ void IPAIPU3::parseStatistics(unsigned int frame,
 {
 	ControlList ctrls(controls::controls);
 
+	agcAlgo_->process(stats, exposure_, gain_);
 	awbAlgo_->calculateWBGains(stats);
+	if (agcAlgo_->updateControls())
+		setControls(frame);
 
 	ipa::ipu3::IPU3Action op;
 	op.op = ipa::ipu3::ActionMetadataReady;
diff --git a/src/ipa/ipu3/ipu3_agc.cpp b/src/ipa/ipu3/ipu3_agc.cpp
new file mode 100644
index 00000000..6cb657b3
--- /dev/null
+++ b/src/ipa/ipu3/ipu3_agc.cpp
@@ -0,0 +1,228 @@
+/* SPDX-License-Identifier: LGPL-2.1-or-later */
+/*
+ * Copyright (C) 2021, Ideas On Board
+ *
+ * ipu3_agc.cpp - AGC/AEC control algorithm
+ */
+
+#include "ipu3_agc.h"
+
+#include <algorithm>
+#include <cmath>
+#include <numeric>
+
+#include "libcamera/internal/log.h"
+
+#include "libipa/histogram.h"
+
+namespace libcamera {
+
+namespace ipa {
+
+LOG_DEFINE_CATEGORY(IPU3Agc)
+
+/* Number of frames to wait before calculating stats on minimum exposure */
+static const uint32_t kInitialFrameMinAECount = 4;
+/* Number of frames to wait between new gain/exposure estimations */
+static const uint32_t kFrameSkipCount = 6;
+
+/* Maximum ISO value for analogue gain */
+static const uint32_t kMinISO = 100;
+static const uint32_t kMaxISO = 1500;
+/* Maximum analogue gain value
+ * \todo grab it from a camera helper */
+static const uint32_t kMinGain = kMinISO / 100;
+static const uint32_t kMaxGain = kMaxISO / 100;
+/* \todo use calculated value based on sensor */
+static const uint32_t kMinExposure = 1;
+static const uint32_t kMaxExposure = 1976;
+/* \todo those should be get from pipeline handler ! */
+/* line duration in microseconds */
+static const double kLineDuration = 16.8;
+static const double kMaxExposureTime = kMaxExposure * kLineDuration;
+/* Histogram constants */
+static const uint32_t knumHistogramBins = 256;
+static const double kEvGainTarget = 0.5;
+
+IPU3Agc::IPU3Agc()
+	: frameCount_(0), lastFrame_(0),
+	  converged_(false), updateControls_(false)
+{
+	iqMean_ = 0.0;
+	gamma_ = 1.0;
+	histLow_ = 0;
+	histHigh_ = 255;
+	prevTotalExposure_ = 0.0;
+	prevTotalExposureNoDg_ = 0.0;
+	currentTotalExposure_ = 0.0;
+	currentTotalExposureNoDg_ = 0.0;
+}
+
+IPU3Agc::~IPU3Agc()
+{
+}
+
+void IPU3Agc::initialise(struct ipu3_uapi_grid_config &bdsGrid)
+{
+	aeGrid_ = bdsGrid;
+}
+void IPU3Agc::processBrightness(const ipu3_uapi_stats_3a *stats)
+{
+	const struct ipu3_uapi_grid_config statsAeGrid = stats->stats_4a_config.awb_config.grid;
+	Rectangle aeRegion = { statsAeGrid.x_start,
+			       statsAeGrid.y_start,
+			       static_cast<unsigned int>(statsAeGrid.x_end - statsAeGrid.x_start) + 1,
+			       static_cast<unsigned int>(statsAeGrid.y_end - statsAeGrid.y_start) + 1 };
+	Point topleft = aeRegion.topLeft();
+	uint32_t startY = (topleft.y >> aeGrid_.block_height_log2) * aeGrid_.width << aeGrid_.block_width_log2;
+	uint32_t startX = (topleft.x >> aeGrid_.block_width_log2) << aeGrid_.block_width_log2;
+	uint32_t endX = (startX + (aeRegion.size().width >> aeGrid_.block_width_log2)) << aeGrid_.block_width_log2;
+	uint32_t i, j;
+	uint32_t count = 0;
+
+	cellsBrightness_.clear();
+
+	for (j = (topleft.y >> aeGrid_.block_height_log2);
+	     j < (topleft.y >> aeGrid_.block_height_log2) + (aeRegion.size().height >> aeGrid_.block_height_log2);
+	     j++) {
+		for (i = startX + startY; i < endX + startY; i += 8) {
+			/* grid width (and maybe height) is not reliable.
+			 * We observed a bit shift which makes the value 160 to be 32 in the stats grid.
+			 * Use the one passed at init time. */
+			if (stats->awb_raw_buffer.meta_data[i + 4 + j * aeGrid_.width] == 0) {
+				uint8_t Gr = stats->awb_raw_buffer.meta_data[i + j * aeGrid_.width];
+				uint8_t R = stats->awb_raw_buffer.meta_data[i + 1 + j * aeGrid_.width];
+				uint8_t B = stats->awb_raw_buffer.meta_data[i + 2 + j * aeGrid_.width];
+				uint8_t Gb = stats->awb_raw_buffer.meta_data[i + 3 + j * aeGrid_.width];
+
+				cellsBrightness_.push_back(static_cast<uint32_t>(0.2125 * R + 0.7154 * (Gr + Gb) / 2 + 0.0722 * B));
+				count++;
+			}
+		}
+	}
+	std::vector<uint32_t>::iterator maxIntensity = std::max_element(cellsBrightness_.begin(), cellsBrightness_.end());
+	LOG(IPU3Agc, Debug) << "Most frequent intensity is " << *maxIntensity << " at " << std::distance(cellsBrightness_.begin(), maxIntensity);
+
+	/* \todo create a class to generate histograms ! */
+	uint32_t hist[knumHistogramBins] = { 0 };
+	for (uint32_t const &val : cellsBrightness_)
+		hist[val]++;
+
+	double mean = 0.0;
+	for (i = 0; i < knumHistogramBins; i++) {
+		mean += hist[i] * i;
+	}
+	mean /= count;
+
+	double variance = 0.0;
+	for (i = 0; i < knumHistogramBins; i++) {
+		variance += ((i - mean) * (i - mean)) * hist[i];
+	}
+	variance /= count;
+	variance = std::sqrt(variance);
+
+	LOG(IPU3Agc, Debug) << "mean value is: " << mean << " and variance is " << variance;
+	/* Limit the gamma effect for now */
+	gamma_ = 1.1;
+
+	const auto [minBrightness, maxBrightness] = std::minmax_element(cellsBrightness_.begin(), cellsBrightness_.end());
+	histLow_ = *minBrightness;
+	histHigh_ = *maxBrightness;
+
+	iqMean_ = Histogram(Span<uint32_t>(hist)).interQuantileMean(0.98, 1.0);
+}
+
+void IPU3Agc::filterExposure(bool desaturate)
+{
+	double speed = 0.2;
+	if (prevTotalExposure_ == 0.0) {
+		prevTotalExposure_ = currentTotalExposure_;
+		prevTotalExposureNoDg_ = currentTotalExposureNoDg_;
+	} else {
+		/* If close to the result go faster, to save making so many
+		 * micro-adjustments on the way.
+		 * \ todo: Make this customisable? */
+		if (prevTotalExposure_ < 1.2 * currentTotalExposure_ &&
+		    prevTotalExposure_ > 0.8 * currentTotalExposure_)
+			speed = sqrt(speed);
+		prevTotalExposure_ = speed * currentTotalExposure_ +
+				     prevTotalExposure_ * (1.0 - speed);
+		/* When desaturing, take a big jump down in exposure_no_dg,
+		 * which we'll hide with digital gain. */
+		if (desaturate)
+			prevTotalExposureNoDg_ =
+				currentTotalExposureNoDg_;
+		else
+			prevTotalExposureNoDg_ =
+				speed * currentTotalExposureNoDg_ +
+				prevTotalExposureNoDg_ * (1.0 - speed);
+	}
+	/* We can't let the no_dg exposure deviate too far below the
+	 * total exposure, as there might not be enough digital gain available
+	 * in the ISP to hide it (which will cause nasty oscillation). */
+	double fastReduceThreshold = 0.4;
+	if (prevTotalExposureNoDg_ <
+	    prevTotalExposure_ * fastReduceThreshold)
+		prevTotalExposureNoDg_ = prevTotalExposure_ * fastReduceThreshold;
+	LOG(IPU3Agc, Debug) << "After filtering, total_exposure " << prevTotalExposure_;
+}
+
+void IPU3Agc::lockExposureGain(uint32_t &exposure, uint32_t &gain)
+{
+	updateControls_ = false;
+
+	/* Algorithm initialization wait for first valid frames */
+	/* \todo - have a number of frames given by DelayedControls ?
+	 * - implement a function for IIR */
+	if ((frameCount_ == kInitialFrameMinAECount) || (frameCount_ - lastFrame_ >= kFrameSkipCount)) {
+		/* Are we correctly exposed ? */
+		double newGain = kEvGainTarget * knumHistogramBins / iqMean_;
+
+		if (std::abs(iqMean_ - kEvGainTarget * knumHistogramBins) <= 1) {
+			LOG(IPU3Agc, Debug) << "!!! Good exposure with iqMean = " << iqMean_;
+			converged_ = true;
+		} else {
+			/* extracted from Rpi::Agc::computeTargetExposure */
+			double currentShutter = exposure * kLineDuration;
+			currentTotalExposureNoDg_ = currentShutter * gain;
+			LOG(IPU3Agc, Debug) << "Actual total exposure " << currentTotalExposureNoDg_
+					    << " Shutter speed " << currentShutter
+					    << " Gain " << gain;
+			currentTotalExposure_ = currentTotalExposureNoDg_ * newGain;
+			double maxTotalExposure = kMaxExposureTime * kMaxGain;
+			currentTotalExposure_ = std::min(currentTotalExposure_, maxTotalExposure);
+			LOG(IPU3Agc, Debug) << "Target total exposure " << currentTotalExposure_;
+
+			/* \todo: estimate if we need to desaturate */
+			filterExposure(false);
+
+			double newExposure = 0.0;
+			if (currentShutter < kMaxExposureTime) {
+				exposure = std::clamp(static_cast<uint32_t>(exposure * currentTotalExposure_ / currentTotalExposureNoDg_), kMinExposure, kMaxExposure);
+				newExposure = currentTotalExposure_ / exposure;
+				gain = std::clamp(static_cast<uint32_t>(gain * currentTotalExposure_ / newExposure), kMinGain, kMaxGain);
+				updateControls_ = true;
+			} else if (currentShutter >= kMaxExposureTime) {
+				gain = std::clamp(static_cast<uint32_t>(gain * currentTotalExposure_ / currentTotalExposureNoDg_), kMinGain, kMaxGain);
+				newExposure = currentTotalExposure_ / gain;
+				exposure = std::clamp(static_cast<uint32_t>(exposure * currentTotalExposure_ / newExposure), kMinExposure, kMaxExposure);
+				updateControls_ = true;
+			}
+			LOG(IPU3Agc, Debug) << "Adjust exposure " << exposure * kLineDuration << " and gain " << gain;
+		}
+		lastFrame_ = frameCount_;
+	} else {
+		updateControls_ = false;
+	}
+}
+
+void IPU3Agc::process(const ipu3_uapi_stats_3a *stats, uint32_t &exposure, uint32_t &gain)
+{
+	processBrightness(stats);
+	lockExposureGain(exposure, gain);
+	frameCount_++;
+}
+
+} /* namespace ipa */
+
+} /* namespace libcamera */
diff --git a/src/ipa/ipu3/ipu3_agc.h b/src/ipa/ipu3/ipu3_agc.h
new file mode 100644
index 00000000..d4657a81
--- /dev/null
+++ b/src/ipa/ipu3/ipu3_agc.h
@@ -0,0 +1,67 @@
+/* SPDX-License-Identifier: LGPL-2.1-or-later */
+/*
+ * Copyright (C) 2021, Ideas On Board
+ *
+ * ipu3_agc.h - IPU3 AGC/AEC control algorithm
+ */
+#ifndef __LIBCAMERA_IPU3_AGC_H__
+#define __LIBCAMERA_IPU3_AGC_H__
+
+#include <unordered_map>
+#include <vector>
+
+#include <linux/intel-ipu3.h>
+
+#include <libcamera/geometry.h>
+
+#include "libipa/algorithm.h"
+
+namespace libcamera {
+
+namespace ipa {
+
+class IPU3Agc : public Algorithm
+{
+public:
+	IPU3Agc();
+	~IPU3Agc();
+
+	void initialise(struct ipu3_uapi_grid_config &bdsGrid);
+	void process(const ipu3_uapi_stats_3a *stats, uint32_t &exposure, uint32_t &gain);
+	bool converged() { return converged_; }
+	bool updateControls() { return updateControls_; }
+	/* \todo Use a metadata exchange between IPAs */
+	double gamma() { return gamma_; }
+
+private:
+	void processBrightness(const ipu3_uapi_stats_3a *stats);
+	void filterExposure(bool desaturate);
+	void lockExposureGain(uint32_t &exposure, uint32_t &gain);
+
+	struct ipu3_uapi_grid_config aeGrid_;
+
+	uint64_t frameCount_;
+	uint64_t lastFrame_;
+
+	/* Vector of calculated brightness for each cell */
+	std::vector<uint32_t> cellsBrightness_;
+
+	bool converged_;
+	bool updateControls_;
+
+	double iqMean_;
+	double gamma_;
+	uint32_t histLow_;
+	uint32_t histHigh_;
+
+	double prevTotalExposure_;
+	double prevTotalExposureNoDg_;
+	double currentTotalExposure_;
+	double currentTotalExposureNoDg_;
+};
+
+} /* namespace ipa */
+
+} /* namespace libcamera */
+
+#endif /* __LIBCAMERA_IPU3_AGC_H__ */
diff --git a/src/ipa/ipu3/meson.build b/src/ipa/ipu3/meson.build
index 1040698e..adeae28b 100644
--- a/src/ipa/ipu3/meson.build
+++ b/src/ipa/ipu3/meson.build
@@ -5,6 +5,7 @@ ipa_name = 'ipa_ipu3'
 ipu3_ipa_sources = files([
     'ipu3.cpp',
     'ipu3_awb.cpp',
+    'ipu3_agc.cpp',
 ])
 
 mod = shared_module(ipa_name,
-- 
2.27.0



More information about the libcamera-devel mailing list