[libcamera-devel] [PATCH v2 06/10] ipa: libipa: Provide a common base for FrameContexts
Jacopo Mondi
jacopo at jmondi.org
Fri Aug 5 15:53:08 CEST 2022
From: Kieran Bingham via libcamera-devel <libcamera-devel at lists.libcamera.org>
Provide a common IPAFrameContext as a base for IPA modules to inherit
from.
This will allow having a common set of parameters for every FrameContext
required by the FCQueue implementation.
Make both the RKISP1 and the IPU3 define IPA specific FrameContext
structures which inherit from the IPAFrameContext.
While adjusting interface to Algorithm::process() the FrameContext is
converted from a pointer to a reference.
Signed-off-by: Kieran Bingham <kieran.bingham at ideasonboard.com>
Signed-off-by: Jacopo Mondi <jacopo at jmondi.org>
---
src/ipa/ipu3/algorithms/af.cpp | 3 ++-
src/ipa/ipu3/algorithms/af.h | 2 +-
src/ipa/ipu3/algorithms/agc.cpp | 9 ++++----
src/ipa/ipu3/algorithms/agc.h | 4 ++--
src/ipa/ipu3/algorithms/awb.cpp | 3 ++-
src/ipa/ipu3/algorithms/awb.h | 2 +-
src/ipa/ipu3/algorithms/tone_mapping.cpp | 3 ++-
src/ipa/ipu3/algorithms/tone_mapping.h | 2 +-
src/ipa/ipu3/ipa_context.cpp | 29 ++++--------------------
src/ipa/ipu3/ipa_context.h | 8 ++-----
src/ipa/ipu3/ipu3.cpp | 6 ++---
src/ipa/ipu3/module.h | 2 +-
src/ipa/libipa/algorithm.h | 2 +-
src/ipa/libipa/fc_queue.cpp | 21 +++++++++++++++++
src/ipa/libipa/fc_queue.h | 5 ++++
src/ipa/rkisp1/algorithms/agc.cpp | 2 +-
src/ipa/rkisp1/algorithms/agc.h | 2 +-
src/ipa/rkisp1/algorithms/awb.cpp | 2 +-
src/ipa/rkisp1/algorithms/awb.h | 2 +-
src/ipa/rkisp1/ipa_context.h | 4 +++-
src/ipa/rkisp1/module.h | 2 +-
src/ipa/rkisp1/rkisp1.cpp | 5 +++-
22 files changed, 66 insertions(+), 54 deletions(-)
diff --git a/src/ipa/ipu3/algorithms/af.cpp b/src/ipa/ipu3/algorithms/af.cpp
index d07521a090ac..fcbf8e557b10 100644
--- a/src/ipa/ipu3/algorithms/af.cpp
+++ b/src/ipa/ipu3/algorithms/af.cpp
@@ -420,7 +420,8 @@ bool Af::afIsOutOfFocus(IPAContext context)
*
* [1] Hill Climbing Algorithm, https://en.wikipedia.org/wiki/Hill_climbing
*/
-void Af::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+void Af::process(IPAContext &context,
+ [[maybe_unused]] IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats)
{
/* Evaluate the AF buffer length */
diff --git a/src/ipa/ipu3/algorithms/af.h b/src/ipa/ipu3/algorithms/af.h
index ccf015f3f8f5..7a5aeb1b6bf4 100644
--- a/src/ipa/ipu3/algorithms/af.h
+++ b/src/ipa/ipu3/algorithms/af.h
@@ -32,7 +32,7 @@ public:
void prepare(IPAContext &context, ipu3_uapi_params *params) override;
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void process(IPAContext &context, IPAFrameContext *frameContext,
+ void process(IPAContext &context, IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats) override;
private:
diff --git a/src/ipa/ipu3/algorithms/agc.cpp b/src/ipa/ipu3/algorithms/agc.cpp
index 5bc64ae52214..92ea6249798d 100644
--- a/src/ipa/ipu3/algorithms/agc.cpp
+++ b/src/ipa/ipu3/algorithms/agc.cpp
@@ -183,13 +183,13 @@ utils::Duration Agc::filterExposure(utils::Duration exposureValue)
* \param[in] yGain The gain calculated based on the relative luminance target
* \param[in] iqMeanGain The gain calculated based on the relative luminance target
*/
-void Agc::computeExposure(IPAContext &context, IPAFrameContext *frameContext,
+void Agc::computeExposure(IPAContext &context, IPU3FrameContext &frameContext,
double yGain, double iqMeanGain)
{
const IPASessionConfiguration &configuration = context.configuration;
/* Get the effective exposure and gain applied on the sensor. */
- uint32_t exposure = frameContext->sensor.exposure;
- double analogueGain = frameContext->sensor.gain;
+ uint32_t exposure = frameContext.sensor.exposure;
+ double analogueGain = frameContext.sensor.gain;
/* Use the highest of the two gain estimates. */
double evGain = std::max(yGain, iqMeanGain);
@@ -323,7 +323,8 @@ double Agc::estimateLuminance(IPAActiveState &activeState,
* Identify the current image brightness, and use that to estimate the optimal
* new exposure and gain for the scene.
*/
-void Agc::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+void Agc::process(IPAContext &context,
+ IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats)
{
/*
diff --git a/src/ipa/ipu3/algorithms/agc.h b/src/ipa/ipu3/algorithms/agc.h
index 105ae0f2aac6..96585f48933f 100644
--- a/src/ipa/ipu3/algorithms/agc.h
+++ b/src/ipa/ipu3/algorithms/agc.h
@@ -28,14 +28,14 @@ public:
~Agc() = default;
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void process(IPAContext &context, IPAFrameContext *frameContext,
+ void process(IPAContext &context, IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats) override;
private:
double measureBrightness(const ipu3_uapi_stats_3a *stats,
const ipu3_uapi_grid_config &grid) const;
utils::Duration filterExposure(utils::Duration currentExposure);
- void computeExposure(IPAContext &context, IPAFrameContext *frameContext,
+ void computeExposure(IPAContext &context, IPU3FrameContext &frameContext,
double yGain, double iqMeanGain);
double estimateLuminance(IPAActiveState &activeState,
const ipu3_uapi_grid_config &grid,
diff --git a/src/ipa/ipu3/algorithms/awb.cpp b/src/ipa/ipu3/algorithms/awb.cpp
index 704267222a31..45f8e5f29119 100644
--- a/src/ipa/ipu3/algorithms/awb.cpp
+++ b/src/ipa/ipu3/algorithms/awb.cpp
@@ -387,7 +387,8 @@ void Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats)
/**
* \copydoc libcamera::ipa::Algorithm::process
*/
-void Awb::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+void Awb::process(IPAContext &context,
+ [[maybe_unused]] IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats)
{
calculateWBGains(stats);
diff --git a/src/ipa/ipu3/algorithms/awb.h b/src/ipa/ipu3/algorithms/awb.h
index 0acd21480845..28e39620fd59 100644
--- a/src/ipa/ipu3/algorithms/awb.h
+++ b/src/ipa/ipu3/algorithms/awb.h
@@ -40,7 +40,7 @@ public:
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
void prepare(IPAContext &context, ipu3_uapi_params *params) override;
- void process(IPAContext &context, IPAFrameContext *frameContext,
+ void process(IPAContext &context, IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats) override;
private:
diff --git a/src/ipa/ipu3/algorithms/tone_mapping.cpp b/src/ipa/ipu3/algorithms/tone_mapping.cpp
index f86e79b24a67..977741c5a4d4 100644
--- a/src/ipa/ipu3/algorithms/tone_mapping.cpp
+++ b/src/ipa/ipu3/algorithms/tone_mapping.cpp
@@ -78,7 +78,8 @@ void ToneMapping::prepare([[maybe_unused]] IPAContext &context,
* The tone mapping look up table is generated as an inverse power curve from
* our gamma setting.
*/
-void ToneMapping::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+void ToneMapping::process(IPAContext &context,
+ [[maybe_unused]] IPU3FrameContext &frameContext,
[[maybe_unused]] const ipu3_uapi_stats_3a *stats)
{
/*
diff --git a/src/ipa/ipu3/algorithms/tone_mapping.h b/src/ipa/ipu3/algorithms/tone_mapping.h
index d7d4800628f2..8cce38c742a6 100644
--- a/src/ipa/ipu3/algorithms/tone_mapping.h
+++ b/src/ipa/ipu3/algorithms/tone_mapping.h
@@ -20,7 +20,7 @@ public:
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
void prepare(IPAContext &context, ipu3_uapi_params *params) override;
- void process(IPAContext &context, IPAFrameContext *frameContext,
+ void process(IPAContext &context, IPU3FrameContext &frameContext,
const ipu3_uapi_stats_3a *stats) override;
private:
diff --git a/src/ipa/ipu3/ipa_context.cpp b/src/ipa/ipu3/ipa_context.cpp
index 9605c8a1106d..536d76ecd63b 100644
--- a/src/ipa/ipu3/ipa_context.cpp
+++ b/src/ipa/ipu3/ipa_context.cpp
@@ -35,22 +35,6 @@ namespace libcamera::ipa::ipu3 {
* most recently computed by the IPA algorithms.
*/
-/**
- * \struct IPAFrameContext
- * \brief Context for a frame
- *
- * The frame context stores data specific to a single frame processed by the
- * IPA. Each frame processed by the IPA has a context associated with it,
- * accessible through the IPAContext structure.
- *
- * Fields in the frame context should reflect values and controls
- * associated with the specific frame as requested by the application, and
- * as configured by the hardware. Fields can be read by algorithms to
- * determine if they should update any specific action for this frame, and
- * finally to update the metadata control lists when the frame is fully
- * completed.
- */
-
/**
* \struct IPAContext
* \brief Global IPA context data shared between all algorithms
@@ -181,20 +165,17 @@ namespace libcamera::ipa::ipu3 {
*/
/**
- * \var IPAFrameContext::frame
- * \brief The frame number
+ * \struct IPU3FrameContext
+ * \copybrief libcamera::ipa::IPAFrameContext
*
- * \var IPAFrameContext::sensor
+ * \var IPU3FrameContext::sensor
* \brief Effective sensor values that were applied for the frame
*
- * \var IPAFrameContext::sensor.exposure
+ * \var IPU3FrameContext::sensor.exposure
* \brief Exposure time expressed as a number of lines
*
- * \var IPAFrameContext::sensor.gain
+ * \var IPU3FrameContext::sensor.gain
* \brief Analogue gain multiplier
- *
- * \var IPAFrameContext::error
- * \brief The error flags for this frame context
*/
} /* namespace libcamera::ipa::ipu3 */
diff --git a/src/ipa/ipu3/ipa_context.h b/src/ipa/ipu3/ipa_context.h
index dc5b7c30aaf9..c4aa4c3f4f6a 100644
--- a/src/ipa/ipu3/ipa_context.h
+++ b/src/ipa/ipu3/ipa_context.h
@@ -14,7 +14,6 @@
#include <libcamera/controls.h>
#include <libcamera/geometry.h>
-#include <libcamera/request.h>
#include <libipa/fc_queue.h>
@@ -74,22 +73,19 @@ struct IPAActiveState {
} toneMapping;
};
-struct IPAFrameContext {
- uint32_t frame;
+struct IPU3FrameContext : public IPAFrameContext {
struct {
uint32_t exposure;
double gain;
} sensor;
-
- Request::Errors error;
};
struct IPAContext {
IPASessionConfiguration configuration;
IPAActiveState activeState;
- FCQueue<IPAFrameContext> frameContexts;
+ FCQueue<IPU3FrameContext> frameContexts;
};
} /* namespace ipa::ipu3 */
diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp
index 209a6b040f8f..24839fd1edee 100644
--- a/src/ipa/ipu3/ipu3.cpp
+++ b/src/ipa/ipu3/ipu3.cpp
@@ -569,7 +569,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame,
const ipu3_uapi_stats_3a *stats =
reinterpret_cast<ipu3_uapi_stats_3a *>(mem.data());
- IPAFrameContext &frameContext = context_.frameContexts.get(frame);
+ IPU3FrameContext &frameContext = context_.frameContexts.get(frame);
if (frameContext.frame != frame)
LOG(IPAIPU3, Warning) << "Frame " << frame << " does not match its frame context";
@@ -582,7 +582,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame,
ControlList ctrls(controls::controls);
for (auto const &algo : algorithms_)
- algo->process(context_, &frameContext, stats);
+ algo->process(context_, frameContext, stats);
setControls(frame);
@@ -618,7 +618,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame,
void IPAIPU3::queueRequest(const uint32_t frame, const ControlList &controls)
{
/* \todo Start processing for 'frame' based on 'controls'. */
- IPAFrameContext &frameContext = context_.frameContexts.initialise(frame);
+ IPU3FrameContext &frameContext = context_.frameContexts.initialise(frame);
/* \todo Implement queueRequest to each algorithm. */
(void)frameContext;
diff --git a/src/ipa/ipu3/module.h b/src/ipa/ipu3/module.h
index d94fc4594871..6d0d50f615d8 100644
--- a/src/ipa/ipu3/module.h
+++ b/src/ipa/ipu3/module.h
@@ -19,7 +19,7 @@ namespace libcamera {
namespace ipa::ipu3 {
-using Module = ipa::Module<IPAContext, IPAFrameContext, IPAConfigInfo,
+using Module = ipa::Module<IPAContext, IPU3FrameContext, IPAConfigInfo,
ipu3_uapi_params, ipu3_uapi_stats_3a>;
} /* namespace ipa::ipu3 */
diff --git a/src/ipa/libipa/algorithm.h b/src/ipa/libipa/algorithm.h
index ccc659a63e3b..0fe3d772963a 100644
--- a/src/ipa/libipa/algorithm.h
+++ b/src/ipa/libipa/algorithm.h
@@ -49,7 +49,7 @@ public:
}
virtual void process([[maybe_unused]] typename Module::Context &context,
- [[maybe_unused]] typename Module::FrameContext *frameContext,
+ [[maybe_unused]] typename Module::FrameContext &frameContext,
[[maybe_unused]] const typename Module::Stats *stats)
{
}
diff --git a/src/ipa/libipa/fc_queue.cpp b/src/ipa/libipa/fc_queue.cpp
index 37ffca60b992..f0d0b3c7168d 100644
--- a/src/ipa/libipa/fc_queue.cpp
+++ b/src/ipa/libipa/fc_queue.cpp
@@ -66,6 +66,27 @@ namespace ipa {
* the PFCError flag is automatically raised on the FrameContext.
*/
+/**
+ * \struct IPAFrameContext
+ * \brief Context for a frame
+ *
+ * The frame context stores data specific to a single frame processed by the
+ * IPA. Each frame processed by the IPA has a context associated with it,
+ * accessible through the Frame Context Queue.
+ *
+ * Fields in the frame context should reflect values and controls associated
+ * with the specific frame as requested by the application, and as configured by
+ * the hardware. Fields can be read by algorithms to determine if they should
+ * update any specific action for this frame, and finally to update the metadata
+ * control lists when the frame is fully completed.
+ *
+ * \var IPAFrameContext::frame
+ * \brief The frame number
+ *
+ * \var IPAFrameContext::error
+ * \brief The error flags associated with the frame
+ */
+
/**
* \fn FCQueue::clear()
* \brief Clear the context queue
diff --git a/src/ipa/libipa/fc_queue.h b/src/ipa/libipa/fc_queue.h
index 023b52420fe7..73b7f25f8c20 100644
--- a/src/ipa/libipa/fc_queue.h
+++ b/src/ipa/libipa/fc_queue.h
@@ -26,6 +26,11 @@ namespace ipa {
*/
static constexpr uint32_t kMaxFrameContexts = 16;
+struct IPAFrameContext {
+ unsigned int frame;
+ Request::Errors error;
+};
+
template<typename FrameContext>
class FCQueue : private std::array<FrameContext, kMaxFrameContexts>
{
diff --git a/src/ipa/rkisp1/algorithms/agc.cpp b/src/ipa/rkisp1/algorithms/agc.cpp
index 483e941fe427..40d27963ef68 100644
--- a/src/ipa/rkisp1/algorithms/agc.cpp
+++ b/src/ipa/rkisp1/algorithms/agc.cpp
@@ -281,7 +281,7 @@ double Agc::measureBrightness(const rkisp1_cif_isp_hist_stat *hist) const
* new exposure and gain for the scene.
*/
void Agc::process(IPAContext &context,
- [[maybe_unused]] IPAFrameContext *frameContext,
+ [[maybe_unused]] RKISP1FrameContext &frameContext,
const rkisp1_stat_buffer *stats)
{
const rkisp1_cif_isp_stat *params = &stats->params;
diff --git a/src/ipa/rkisp1/algorithms/agc.h b/src/ipa/rkisp1/algorithms/agc.h
index 1c9818b7db2a..af7fe2740908 100644
--- a/src/ipa/rkisp1/algorithms/agc.h
+++ b/src/ipa/rkisp1/algorithms/agc.h
@@ -27,7 +27,7 @@ public:
int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override;
void prepare(IPAContext &context, rkisp1_params_cfg *params) override;
- void process(IPAContext &context, IPAFrameContext *frameContext,
+ void process(IPAContext &context, RKISP1FrameContext &frameContext,
const rkisp1_stat_buffer *stats) override;
private:
diff --git a/src/ipa/rkisp1/algorithms/awb.cpp b/src/ipa/rkisp1/algorithms/awb.cpp
index 427aaeb1e955..3beafb73ca33 100644
--- a/src/ipa/rkisp1/algorithms/awb.cpp
+++ b/src/ipa/rkisp1/algorithms/awb.cpp
@@ -120,7 +120,7 @@ void Awb::prepare(IPAContext &context, rkisp1_params_cfg *params)
* \copydoc libcamera::ipa::Algorithm::process
*/
void Awb::process([[maybe_unused]] IPAContext &context,
- [[maybe_unused]] IPAFrameContext *frameCtx,
+ [[maybe_unused]] RKISP1FrameContext &frameCtx,
const rkisp1_stat_buffer *stats)
{
const rkisp1_cif_isp_stat *params = &stats->params;
diff --git a/src/ipa/rkisp1/algorithms/awb.h b/src/ipa/rkisp1/algorithms/awb.h
index 667a8beb7689..5954034b8142 100644
--- a/src/ipa/rkisp1/algorithms/awb.h
+++ b/src/ipa/rkisp1/algorithms/awb.h
@@ -21,7 +21,7 @@ public:
int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override;
void prepare(IPAContext &context, rkisp1_params_cfg *params) override;
- void process(IPAContext &context, IPAFrameContext *frameCtx,
+ void process(IPAContext &context, RKISP1FrameContext &frameCtx,
const rkisp1_stat_buffer *stats) override;
private:
diff --git a/src/ipa/rkisp1/ipa_context.h b/src/ipa/rkisp1/ipa_context.h
index a8daeca487ae..c42bcd73b314 100644
--- a/src/ipa/rkisp1/ipa_context.h
+++ b/src/ipa/rkisp1/ipa_context.h
@@ -14,6 +14,8 @@
#include <libcamera/geometry.h>
+#include <libipa/fc_queue.h>
+
namespace libcamera {
namespace ipa::rkisp1 {
@@ -78,7 +80,7 @@ struct IPAActiveState {
unsigned int frameCount;
};
-struct IPAFrameContext {
+struct RKISP1FrameContext : public IPAFrameContext {
};
struct IPAContext {
diff --git a/src/ipa/rkisp1/module.h b/src/ipa/rkisp1/module.h
index 89f83208a75c..2568c624df0f 100644
--- a/src/ipa/rkisp1/module.h
+++ b/src/ipa/rkisp1/module.h
@@ -19,7 +19,7 @@ namespace libcamera {
namespace ipa::rkisp1 {
-using Module = ipa::Module<IPAContext, IPAFrameContext, IPACameraSensorInfo,
+using Module = ipa::Module<IPAContext, RKISP1FrameContext, IPACameraSensorInfo,
rkisp1_params_cfg, rkisp1_stat_buffer>;
} /* namespace ipa::rkisp1 */
diff --git a/src/ipa/rkisp1/rkisp1.cpp b/src/ipa/rkisp1/rkisp1.cpp
index a64716f588a8..a2483f27cf52 100644
--- a/src/ipa/rkisp1/rkisp1.cpp
+++ b/src/ipa/rkisp1/rkisp1.cpp
@@ -329,8 +329,11 @@ void IPARkISP1::processStatsBuffer(const uint32_t frame, const uint32_t bufferId
unsigned int aeState = 0;
+ /* \todo Obtain the frame context to pass to process from the FCQueue */
+ RKISP1FrameContext frameContext;
+
for (auto const &algo : algorithms())
- algo->process(context_, nullptr, stats);
+ algo->process(context_, frameContext, stats);
setControls(frame);
--
2.37.1
More information about the libcamera-devel
mailing list