[libcamera-devel] [PATCH v3 2/3] ipa: libipa: Add frame context pointer in process()
Umang Jain
umang.jain at ideasonboard.com
Tue May 17 21:18:32 CEST 2022
Currently we have a single structure of IPAFrameContext but
subsequently, we shall have a ring buffer (or similar) container
to keep IPAFrameContext structures for each frame.
It would be a hassle to query out the frame context required for
process() (since they will reside in a ring buffer) by the IPA
for each process. Hence, prepare the process() libipa template to
accept a particular IPAFrameContext early on.
As for this patch, we shall pass in the pointer as nullptr, so
that the changes compile and keep working as-is.
Signed-off-by: Umang Jain <umang.jain at ideasonboard.com>
---
src/ipa/ipu3/algorithms/af.cpp | 4 +++-
src/ipa/ipu3/algorithms/af.h | 3 ++-
src/ipa/ipu3/algorithms/agc.cpp | 4 +++-
src/ipa/ipu3/algorithms/agc.h | 3 ++-
src/ipa/ipu3/algorithms/algorithm.h | 4 +++-
src/ipa/ipu3/algorithms/awb.cpp | 3 ++-
src/ipa/ipu3/algorithms/awb.h | 3 ++-
src/ipa/ipu3/algorithms/tone_mapping.cpp | 3 ++-
src/ipa/ipu3/algorithms/tone_mapping.h | 3 ++-
src/ipa/ipu3/ipu3.cpp | 2 +-
src/ipa/libipa/algorithm.cpp | 1 +
src/ipa/libipa/algorithm.h | 4 +++-
src/ipa/rkisp1/algorithms/agc.cpp | 4 +++-
src/ipa/rkisp1/algorithms/agc.h | 3 ++-
src/ipa/rkisp1/algorithms/algorithm.h | 4 +++-
src/ipa/rkisp1/algorithms/awb.cpp | 4 +++-
src/ipa/rkisp1/algorithms/awb.h | 3 ++-
src/ipa/rkisp1/rkisp1.cpp | 2 +-
18 files changed, 40 insertions(+), 17 deletions(-)
diff --git a/src/ipa/ipu3/algorithms/af.cpp b/src/ipa/ipu3/algorithms/af.cpp
index 8a5a6b1a..d07521a0 100644
--- a/src/ipa/ipu3/algorithms/af.cpp
+++ b/src/ipa/ipu3/algorithms/af.cpp
@@ -406,6 +406,7 @@ bool Af::afIsOutOfFocus(IPAContext context)
/**
* \brief Determine the max contrast image and lens position.
* \param[in] context The IPA context.
+ * \param[in] frameContext The current frame context
* \param[in] stats The statistics buffer of IPU3.
*
* Ideally, a clear image also has a relatively higher contrast. So, every
@@ -419,7 +420,8 @@ bool Af::afIsOutOfFocus(IPAContext context)
*
* [1] Hill Climbing Algorithm, https://en.wikipedia.org/wiki/Hill_climbing
*/
-void Af::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Af::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats)
{
/* Evaluate the AF buffer length */
uint32_t afRawBufferLen = context.configuration.af.afGrid.width *
diff --git a/src/ipa/ipu3/algorithms/af.h b/src/ipa/ipu3/algorithms/af.h
index b85cf941..ccf015f3 100644
--- a/src/ipa/ipu3/algorithms/af.h
+++ b/src/ipa/ipu3/algorithms/af.h
@@ -32,7 +32,8 @@ public:
void prepare(IPAContext &context, ipu3_uapi_params *params) override;
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void process(IPAContext &context, IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats) override;
private:
void afCoarseScan(IPAContext &context);
diff --git a/src/ipa/ipu3/algorithms/agc.cpp b/src/ipa/ipu3/algorithms/agc.cpp
index fdeec09d..383a8deb 100644
--- a/src/ipa/ipu3/algorithms/agc.cpp
+++ b/src/ipa/ipu3/algorithms/agc.cpp
@@ -318,12 +318,14 @@ double Agc::estimateLuminance(IPAActiveState &activeState,
/**
* \brief Process IPU3 statistics, and run AGC operations
* \param[in] context The shared IPA context
+ * \param[in] frameContext The current frame context
* \param[in] stats The IPU3 statistics and ISP results
*
* Identify the current image brightness, and use that to estimate the optimal
* new exposure and gain for the scene.
*/
-void Agc::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Agc::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats)
{
/*
* Estimate the gain needed to have the proportion of pixels in a given
diff --git a/src/ipa/ipu3/algorithms/agc.h b/src/ipa/ipu3/algorithms/agc.h
index 31420841..219a1a96 100644
--- a/src/ipa/ipu3/algorithms/agc.h
+++ b/src/ipa/ipu3/algorithms/agc.h
@@ -28,7 +28,8 @@ public:
~Agc() = default;
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void process(IPAContext &context, IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats) override;
private:
double measureBrightness(const ipu3_uapi_stats_3a *stats,
diff --git a/src/ipa/ipu3/algorithms/algorithm.h b/src/ipa/ipu3/algorithms/algorithm.h
index d2eecc78..234b2bd7 100644
--- a/src/ipa/ipu3/algorithms/algorithm.h
+++ b/src/ipa/ipu3/algorithms/algorithm.h
@@ -17,7 +17,9 @@ namespace libcamera {
namespace ipa::ipu3 {
-using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAConfigInfo, ipu3_uapi_params, ipu3_uapi_stats_3a>;
+using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAFrameContext,
+ IPAConfigInfo, ipu3_uapi_params,
+ ipu3_uapi_stats_3a>;
} /* namespace ipa::ipu3 */
diff --git a/src/ipa/ipu3/algorithms/awb.cpp b/src/ipa/ipu3/algorithms/awb.cpp
index ab6924eb..5c232d92 100644
--- a/src/ipa/ipu3/algorithms/awb.cpp
+++ b/src/ipa/ipu3/algorithms/awb.cpp
@@ -387,7 +387,8 @@ void Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats)
/**
* \copydoc libcamera::ipa::Algorithm::process
*/
-void Awb::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Awb::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats)
{
calculateWBGains(stats);
diff --git a/src/ipa/ipu3/algorithms/awb.h b/src/ipa/ipu3/algorithms/awb.h
index ab4b0a33..9a50a985 100644
--- a/src/ipa/ipu3/algorithms/awb.h
+++ b/src/ipa/ipu3/algorithms/awb.h
@@ -40,7 +40,8 @@ public:
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
void prepare(IPAContext &context, ipu3_uapi_params *params) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void process(IPAContext &context, IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats) override;
private:
/* \todo Make these structs available to all the ISPs ? */
diff --git a/src/ipa/ipu3/algorithms/tone_mapping.cpp b/src/ipa/ipu3/algorithms/tone_mapping.cpp
index 7c78d0d9..f86e79b2 100644
--- a/src/ipa/ipu3/algorithms/tone_mapping.cpp
+++ b/src/ipa/ipu3/algorithms/tone_mapping.cpp
@@ -72,12 +72,13 @@ void ToneMapping::prepare([[maybe_unused]] IPAContext &context,
/**
* \brief Calculate the tone mapping look up table
* \param context The shared IPA context
+ * \param frameContext The current frame context
* \param stats The IPU3 statistics and ISP results
*
* The tone mapping look up table is generated as an inverse power curve from
* our gamma setting.
*/
-void ToneMapping::process(IPAContext &context,
+void ToneMapping::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext,
[[maybe_unused]] const ipu3_uapi_stats_3a *stats)
{
/*
diff --git a/src/ipa/ipu3/algorithms/tone_mapping.h b/src/ipa/ipu3/algorithms/tone_mapping.h
index b727ab1e..d7d48006 100644
--- a/src/ipa/ipu3/algorithms/tone_mapping.h
+++ b/src/ipa/ipu3/algorithms/tone_mapping.h
@@ -20,7 +20,8 @@ public:
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
void prepare(IPAContext &context, ipu3_uapi_params *params) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void process(IPAContext &context, IPAFrameContext *frameContext,
+ const ipu3_uapi_stats_3a *stats) override;
private:
double gamma_;
diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp
index 3b4fc911..16e5028f 100644
--- a/src/ipa/ipu3/ipu3.cpp
+++ b/src/ipa/ipu3/ipu3.cpp
@@ -576,7 +576,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame,
ControlList ctrls(controls::controls);
for (auto const &algo : algorithms_)
- algo->process(context_, stats);
+ algo->process(context_, nullptr, stats);
setControls(frame);
diff --git a/src/ipa/libipa/algorithm.cpp b/src/ipa/libipa/algorithm.cpp
index 398d5372..cce2ed62 100644
--- a/src/ipa/libipa/algorithm.cpp
+++ b/src/ipa/libipa/algorithm.cpp
@@ -64,6 +64,7 @@ namespace ipa {
* \fn Algorithm::process()
* \brief Process ISP statistics, and run algorithm operations
* \param[in] context The shared IPA context
+ * \param[in] frameContext The current frame's context
* \param[in] stats The IPA statistics and ISP results
*
* This function is called while camera is running for every frame processed by
diff --git a/src/ipa/libipa/algorithm.h b/src/ipa/libipa/algorithm.h
index 766aee5d..032a05b5 100644
--- a/src/ipa/libipa/algorithm.h
+++ b/src/ipa/libipa/algorithm.h
@@ -10,7 +10,8 @@ namespace libcamera {
namespace ipa {
-template<typename Context, typename Config, typename Params, typename Stats>
+template<typename Context, typename FrameContext, typename Config,
+ typename Params, typename Stats>
class Algorithm
{
public:
@@ -28,6 +29,7 @@ public:
}
virtual void process([[maybe_unused]] Context &context,
+ [[maybe_unused]] FrameContext *frameContext,
[[maybe_unused]] const Stats *stats)
{
}
diff --git a/src/ipa/rkisp1/algorithms/agc.cpp b/src/ipa/rkisp1/algorithms/agc.cpp
index 5f4c3f93..b5a184d9 100644
--- a/src/ipa/rkisp1/algorithms/agc.cpp
+++ b/src/ipa/rkisp1/algorithms/agc.cpp
@@ -280,7 +280,9 @@ double Agc::measureBrightness(const rkisp1_cif_isp_hist_stat *hist) const
* Identify the current image brightness, and use that to estimate the optimal
* new exposure and gain for the scene.
*/
-void Agc::process(IPAContext &context, const rkisp1_stat_buffer *stats)
+void Agc::process(IPAContext &context,
+ [[maybe_unused]] IPAFrameContext *frameContext,
+ const rkisp1_stat_buffer *stats)
{
const rkisp1_cif_isp_stat *params = &stats->params;
ASSERT(stats->meas_type & RKISP1_CIF_ISP_STAT_AUTOEXP);
diff --git a/src/ipa/rkisp1/algorithms/agc.h b/src/ipa/rkisp1/algorithms/agc.h
index ce1adf27..22c02779 100644
--- a/src/ipa/rkisp1/algorithms/agc.h
+++ b/src/ipa/rkisp1/algorithms/agc.h
@@ -29,7 +29,8 @@ public:
int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override;
void prepare(IPAContext &context, rkisp1_params_cfg *params) override;
- void process(IPAContext &context, const rkisp1_stat_buffer *stats) override;
+ void process(IPAContext &context, IPAFrameContext *frameContext,
+ const rkisp1_stat_buffer *stats) override;
private:
void computeExposure(IPAContext &Context, double yGain, double iqMeanGain);
diff --git a/src/ipa/rkisp1/algorithms/algorithm.h b/src/ipa/rkisp1/algorithms/algorithm.h
index d46c3188..68e3a44e 100644
--- a/src/ipa/rkisp1/algorithms/algorithm.h
+++ b/src/ipa/rkisp1/algorithms/algorithm.h
@@ -19,7 +19,9 @@ namespace libcamera {
namespace ipa::rkisp1 {
-using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPACameraSensorInfo, rkisp1_params_cfg, rkisp1_stat_buffer>;
+using Algorithm = libcamera::ipa::Algorithm<IPAContext, IPAFrameContext,
+ IPACameraSensorInfo, rkisp1_params_cfg,
+ rkisp1_stat_buffer>;
} /* namespace ipa::rkisp1 */
diff --git a/src/ipa/rkisp1/algorithms/awb.cpp b/src/ipa/rkisp1/algorithms/awb.cpp
index be4585c6..88441382 100644
--- a/src/ipa/rkisp1/algorithms/awb.cpp
+++ b/src/ipa/rkisp1/algorithms/awb.cpp
@@ -119,7 +119,9 @@ void Awb::prepare(IPAContext &context, rkisp1_params_cfg *params)
/**
* \copydoc libcamera::ipa::Algorithm::process
*/
-void Awb::process([[maybe_unused]] IPAContext &context, const rkisp1_stat_buffer *stats)
+void Awb::process([[maybe_unused]] IPAContext &context,
+ [[maybe_unused]] IPAFrameContext *frameCtx,
+ const rkisp1_stat_buffer *stats)
{
const rkisp1_cif_isp_stat *params = &stats->params;
const rkisp1_cif_isp_awb_stat *awb = ¶ms->awb;
diff --git a/src/ipa/rkisp1/algorithms/awb.h b/src/ipa/rkisp1/algorithms/awb.h
index 11946643..7647842f 100644
--- a/src/ipa/rkisp1/algorithms/awb.h
+++ b/src/ipa/rkisp1/algorithms/awb.h
@@ -23,7 +23,8 @@ public:
int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override;
void prepare(IPAContext &context, rkisp1_params_cfg *params) override;
- void process(IPAContext &context, const rkisp1_stat_buffer *stats) override;
+ void process(IPAContext &context, IPAFrameContext *frameCtx,
+ const rkisp1_stat_buffer *stats) override;
private:
uint32_t estimateCCT(double red, double green, double blue);
diff --git a/src/ipa/rkisp1/rkisp1.cpp b/src/ipa/rkisp1/rkisp1.cpp
index ef1f0d56..c818a6d7 100644
--- a/src/ipa/rkisp1/rkisp1.cpp
+++ b/src/ipa/rkisp1/rkisp1.cpp
@@ -272,7 +272,7 @@ void IPARkISP1::processStatsBuffer(const uint32_t frame, const uint32_t bufferId
unsigned int aeState = 0;
for (auto const &algo : algorithms_)
- algo->process(context_, stats);
+ algo->process(context_, nullptr, stats);
setControls(frame);
--
2.31.0
More information about the libcamera-devel
mailing list